C25H26N6 — CID 59924674
1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-N,N-bis(prop-2-enyl)benzimidazol-5-amine (PubChem CID 59924674) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-N,N-bis(prop-2-enyl)benzimidazol-5-amine.
| Compound Name | 1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-N,N-bis(prop-2-enyl)benzimidazol-5-amine |
|---|---|
| PubChem CID | 59924674 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[2-[[(1S)-1-phenylethyl]amino]pyrimidin-4-yl]-N,N-bis(prop-2-enyl)benzimidazol-5-amine |
| SMILES | C=CCN(CC=C)c1ccc2c(c1)ncn2-c1ccnc(N[C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C25H26N6/c1-4-15-30(16-5-2)21-11-12-23-22(17-21)27-18-31(23)24-13-14-26-25(29-24)28-19(3)20-9-7-6-8-10-20/h4-14,17-19H,1-2,15-16H2,3H3,(H,26,28,29)/t19-/m0/s1 |
| InChIKey | GERDTBCKXOBHLP-IBGZPJMESA-N |
| XLogP | 5.17 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|