About (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium
(2-acetyloxybenzene-4-id-1-yl) acetate;yttrium (PubChem CID 59925093) has the molecular formula C10H9O4Y-
and a molecular weight of 282.08 g/mol. Its IUPAC name is (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium.
Molecular Properties
| Compound Name | (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium |
| PubChem CID | 59925093 |
| Molecular Formula | C10H9O4Y- |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium |
| SMILES | CC(=O)Oc1c[c-]ccc1OC(C)=O.[Y] |
| InChI | InChI=1S/C10H9O4.Y/c1-7(11)13-9-5-3-4-6-10(9)14-8(2)12;/h3,5-6H,1-2H3;/q-1; |
| InChIKey | IXLJFBIFZSITBV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium?
The IUPAC name of (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium (CID 59925093) is (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium.
What is the SMILES notation for (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium?
The canonical SMILES for (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium is CC(=O)Oc1c[c-]ccc1OC(C)=O.[Y].
What is the InChIKey of (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium?
The InChIKey is IXLJFBIFZSITBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O4.Y/c1-7(11)13-9-5-3-4-6-10(9)14-8(2)12;/h3,5-6H,1-2H3;/q-1;.
What are the key properties of (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium?
(2-acetyloxybenzene-4-id-1-yl) acetate;yttrium has a molecular weight of 282.08 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyloxybenzene-4-id-1-yl) acetate;yttrium is sourced from PubChem (CID 59925093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).