C31H52O2 — CID 59925759
trans-(1R,3S,5Z)-5-[(2E)-2-[1-(3,4,5,5,6,6-hexamethylheptan-2-yl)-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 59925759) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(2E)-2-[1-(3,4,5,5,6,6-hexamethylheptan-2-yl)-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(2E)-2-[1-(3,4,5,5,6,6-hexamethylheptan-2-yl)-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 59925759 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(2E)-2-[1-(3,4,5,5,6,6-hexamethylheptan-2-yl)-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCCC3C2CCC3C(C)C(C)C(C)C(C)(C)C(C)(C)C)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C31H52O2/c1-19(22(4)31(8,9)30(5,6)7)20(2)26-15-16-27-23(11-10-12-28(26)27)13-14-24-17-25(32)18-29(33)21(24)3/h13-14,19-20,22,25-29,32-33H,3,10-12,15-18H2,1-2,4-9H3/b23-13+,24-14-/t19?,20?,22?,25-,26?,27?,28?,29+/m1/s1 |
| InChIKey | AIWPZVQCNREDCG-YJBLAOPASA-N |
| XLogP | 7.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |