C21H32O2 — CID 123575093
trans-(1R,3R)-5-[2-[(3aR,7aR)-1-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 123575093) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is trans-(1R,3R)-5-[2-[(3aR,7aR)-1-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[2-[(3aR,7aR)-1-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 123575093 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | trans-(1R,3R)-5-[2-[(3aR,7aR)-1-propan-2-yl-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=CC=C2CCC[C@@H]3C(C(C)C)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C21H32O2/c1-13(2)17-9-10-18-16(5-4-6-19(17)18)8-7-15-11-20(22)14(3)21(23)12-15/h7-8,13,17-23H,3-6,9-12H2,1-2H3/t17?,18-,19+,20+,21+/m0/s1 |
| InChIKey | PEDIPARCWPCIRT-AALCSNISSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|