C28H48O4 — CID 11662347
trans-(1S,3E,5R)-3-[(2E)-2-[(1S,3aR)-1-[(1R)-1-(4-ethyl-4-hydroxyhexoxy)ethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-5-(hydroxymethyl)cyclohexan-1-ol (PubChem CID 11662347) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is trans-(1S,3E,5R)-3-[(2E)-2-[(1S,3aR)-1-[(1R)-1-(4-ethyl-4-hydroxyhexoxy)ethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-5-(hydroxymethyl)cyclohexan-1-ol.
| Compound Name | trans-(1S,3E,5R)-3-[(2E)-2-[(1S,3aR)-1-[(1R)-1-(4-ethyl-4-hydroxyhexoxy)ethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-5-(hydroxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11662347 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | trans-(1S,3E,5R)-3-[(2E)-2-[(1S,3aR)-1-[(1R)-1-(4-ethyl-4-hydroxyhexoxy)ethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-5-(hydroxymethyl)cyclohexan-1-ol |
| SMILES | CCC(O)(CC)CCCO[C@H](C)[C@H]1CC[C@H]2/C(=C/C=C3/C[C@@H](O)C[C@H](CO)C3)CCCC21 |
| InChI | InChI=1S/C28H48O4/c1-4-28(31,5-2)14-7-15-32-20(3)25-12-13-26-23(8-6-9-27(25)26)11-10-21-16-22(19-29)18-24(30)17-21/h10-11,20,22,24-27,29-31H,4-9,12-19H2,1-3H3/b21-10+,23-11+/t20-,22-,24-,25-,26+,27?/m1/s1 |
| InChIKey | VYVRTVDGAXFZFZ-XGQZFGGCSA-N |
| XLogP | 5.56 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|