C25H40O4S — CID 122388054
trans-(1R,3R)-5-[(2Z)-2-[(1S,3aR,7aS)-1-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol (PubChem CID 122388054) has the molecular formula C25H40O4S and a molecular weight of 436.66 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2Z)-2-[(1S,3aR,7aS)-1-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2Z)-2-[(1S,3aR,7aS)-1-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 122388054 |
| Molecular Formula | C25H40O4S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | trans-(1R,3R)-5-[(2Z)-2-[(1S,3aR,7aS)-1-[(1S)-1-(2-hydroxy-2-methylpropyl)sulfanylethyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
| SMILES | C[C@H](SCC(C)(C)O)[C@H]1CC[C@H]2/C(=C\C=C3C[C@@H](O)C(=CCO)[C@H](O)C3)CCC[C@H]12 |
| InChI | InChI=1S/C25H40O4S/c1-16(30-15-25(2,3)29)19-9-10-20-18(5-4-6-21(19)20)8-7-17-13-23(27)22(11-12-26)24(28)14-17/h7-8,11,16,19-21,23-24,26-29H,4-6,9-10,12-15H2,1-3H3/b17-7-,18-8-,22-11+/t16-,19+,20-,21+,23+,24+/m0/s1 |
| InChIKey | QRQCMTXBVASGIB-BADFNLEFSA-N |
| XLogP | 3.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|