C28H27F3N2O2 — CID 59925822
2-[1-[3-(2-methylphenyl)-5-(trifluoromethyl)benzoyl]piperidin-4-yl]-N-phenylacetamide (PubChem CID 59925822) has the molecular formula C28H27F3N2O2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 2-[1-[3-(2-methylphenyl)-5-(trifluoromethyl)benzoyl]piperidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[1-[3-(2-methylphenyl)-5-(trifluoromethyl)benzoyl]piperidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 59925822 |
| Molecular Formula | C28H27F3N2O2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-[1-[3-(2-methylphenyl)-5-(trifluoromethyl)benzoyl]piperidin-4-yl]-N-phenylacetamide |
| SMILES | Cc1ccccc1-c1cc(C(=O)N2CCC(CC(=O)Nc3ccccc3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F3N2O2/c1-19-7-5-6-10-25(19)21-16-22(18-23(17-21)28(29,30)31)27(35)33-13-11-20(12-14-33)15-26(34)32-24-8-3-2-4-9-24/h2-10,16-18,20H,11-15H2,1H3,(H,32,34) |
| InChIKey | VKOHEXWIZSOUKW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |