C18H11F4N3O2S — CID 59925887
5-(3-fluoro-4-methylsulfonylphenyl)-1-(4-isocyanophenyl)-3-(trifluoromethyl)pyrazole (PubChem CID 59925887) has the molecular formula C18H11F4N3O2S and a molecular weight of 409.36 g/mol. Its IUPAC name is 5-(3-fluoro-4-methylsulfonylphenyl)-1-(4-isocyanophenyl)-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-(3-fluoro-4-methylsulfonylphenyl)-1-(4-isocyanophenyl)-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 59925887 |
| Molecular Formula | C18H11F4N3O2S |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 5-(3-fluoro-4-methylsulfonylphenyl)-1-(4-isocyanophenyl)-3-(trifluoromethyl)pyrazole |
| SMILES | [C-]#[N+]c1ccc(-n2nc(C(F)(F)F)cc2-c2ccc(S(C)(=O)=O)c(F)c2)cc1 |
| InChI | InChI=1S/C18H11F4N3O2S/c1-23-12-4-6-13(7-5-12)25-15(10-17(24-25)18(20,21)22)11-3-8-16(14(19)9-11)28(2,26)27/h3-10H,2H3 |
| InChIKey | WWNTWNQKJLOEQF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|