C19H12ClF7N2O5S2 — CID 22316799
[2-chloro-4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-6-methylphenyl] trifluoromethanesulfonate (PubChem CID 22316799) has the molecular formula C19H12ClF7N2O5S2 and a molecular weight of 580.89 g/mol. Its IUPAC name is [2-chloro-4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-6-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-chloro-4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-6-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22316799 |
| Molecular Formula | C19H12ClF7N2O5S2 |
| Molecular Weight | 580.89 g/mol |
| Exact Mass | 579.98 |
| IUPAC Name | [2-chloro-4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-6-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)nn2-c2ccc(S(C)(=O)=O)c(F)c2)cc(Cl)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H12ClF7N2O5S2/c1-9-5-10(6-12(20)17(9)34-36(32,33)19(25,26)27)14-8-16(18(22,23)24)28-29(14)11-3-4-15(13(21)7-11)35(2,30)31/h3-8H,1-2H3 |
| InChIKey | RWELUKBHJNKCLV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|