C10H16N2O — CID 59927515
5-[(3S,4R,5S)-3,4,5-trimethyloxolan-2-yl]-1H-pyrazole (PubChem CID 59927515) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-[(3S,4R,5S)-3,4,5-trimethyloxolan-2-yl]-1H-pyrazole.
| Compound Name | 5-[(3S,4R,5S)-3,4,5-trimethyloxolan-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 59927515 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 5-[(3S,4R,5S)-3,4,5-trimethyloxolan-2-yl]-1H-pyrazole |
| SMILES | C[C@H]1[C@H](C)OC(c2ccn[nH]2)[C@H]1C |
| InChI | InChI=1S/C10H16N2O/c1-6-7(2)10(13-8(6)3)9-4-5-11-12-9/h4-8,10H,1-3H3,(H,11,12)/t6-,7+,8+,10?/m1/s1 |
| InChIKey | YNAJVVCKCHCSAJ-SPHZGDHUSA-N |
| XLogP | 2.14 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |