C9H15N2O2P — CID 59067630
[(3S,4S,5S)-4,5-dimethyl-2-(1H-pyrazol-5-yl)oxolan-3-yl]oxyphosphane (PubChem CID 59067630) has the molecular formula C9H15N2O2P and a molecular weight of 214.21 g/mol. Its IUPAC name is [(3S,4S,5S)-4,5-dimethyl-2-(1H-pyrazol-5-yl)oxolan-3-yl]oxyphosphane.
| Compound Name | [(3S,4S,5S)-4,5-dimethyl-2-(1H-pyrazol-5-yl)oxolan-3-yl]oxyphosphane |
|---|---|
| PubChem CID | 59067630 |
| Molecular Formula | C9H15N2O2P |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | [(3S,4S,5S)-4,5-dimethyl-2-(1H-pyrazol-5-yl)oxolan-3-yl]oxyphosphane |
| SMILES | C[C@H]1[C@H](C)OC(c2ccn[nH]2)[C@H]1OP |
| InChI | InChI=1S/C9H15N2O2P/c1-5-6(2)12-9(8(5)13-14)7-3-4-10-11-7/h3-6,8-9H,14H2,1-2H3,(H,10,11)/t5-,6-,8-,9?/m0/s1 |
| InChIKey | IZAKWYNDGKZMPW-NBZYZMMFSA-N |
| XLogP | 1.68 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|