C8H13N2O7P — CID 91200099
[(2R,3S,4R,5S)-3,4-dihydroxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 91200099) has the molecular formula C8H13N2O7P and a molecular weight of 280.17 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4-dihydroxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 91200099 |
| Molecular Formula | C8H13N2O7P |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4-dihydroxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](c2ccn[nH]2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13N2O7P/c11-6-5(3-16-18(13,14)15)17-8(7(6)12)4-1-2-9-10-4/h1-2,5-8,11-12H,3H2,(H,9,10)(H2,13,14,15)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | UOCATYJQUOHLQO-XUTVFYLZSA-N |
| XLogP | -1.32 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|