C14H22N2O5 — CID 134910074
(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5S)-2,2-dimethyl-5-(1H-pyrazol-5-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 134910074) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5S)-2,2-dimethyl-5-(1H-pyrazol-5-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5S)-2,2-dimethyl-5-(1H-pyrazol-5-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 134910074 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-[(4R,5S)-2,2-dimethyl-5-(1H-pyrazol-5-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CC1(C)OC[C@H]([C@H](O)[C@H]2OC(C)(C)O[C@H]2c2ccn[nH]2)O1 |
| InChI | InChI=1S/C14H22N2O5/c1-13(2)18-7-9(19-13)10(17)12-11(8-5-6-15-16-8)20-14(3,4)21-12/h5-6,9-12,17H,7H2,1-4H3,(H,15,16)/t9-,10+,11+,12-/m1/s1 |
| InChIKey | TYZAAVSGQNCPMA-NOOOWODRSA-N |
| XLogP | 1.11 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |