C14H18N2O7 — CID 91455904
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl acetate (PubChem CID 91455904) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91455904 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(1H-pyrazol-5-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2ccn[nH]2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H18N2O7/c1-7(17)20-6-11-13(21-8(2)18)14(22-9(3)19)12(23-11)10-4-5-15-16-10/h4-5,11-14H,6H2,1-3H3,(H,15,16)/t11-,12+,13-,14+/m1/s1 |
| InChIKey | RLHYXQZYWNRIQF-RQJABVFESA-N |
| XLogP | 0.28 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|