C22H30N2O4 — CID 59930875
[3-(4-ethoxy-2-methylphenyl)-2-oxo-1-azaspiro[4.6]undec-3-en-4-yl] N-ethylcarbamate (PubChem CID 59930875) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is [3-(4-ethoxy-2-methylphenyl)-2-oxo-1-azaspiro[4.6]undec-3-en-4-yl] N-ethylcarbamate.
| Compound Name | [3-(4-ethoxy-2-methylphenyl)-2-oxo-1-azaspiro[4.6]undec-3-en-4-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 59930875 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [3-(4-ethoxy-2-methylphenyl)-2-oxo-1-azaspiro[4.6]undec-3-en-4-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1=C(c2ccc(OCC)cc2C)C(=O)NC12CCCCCC2 |
| InChI | InChI=1S/C22H30N2O4/c1-4-23-21(26)28-19-18(17-11-10-16(27-5-2)14-15(17)3)20(25)24-22(19)12-8-6-7-9-13-22/h10-11,14H,4-9,12-13H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | TYEZQRNHRWDTBY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |