C16H16F2O — CID 59931472
1,3-difluoro-2-methyl-5-(3-phenoxypropyl)benzene (PubChem CID 59931472) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 1,3-difluoro-2-methyl-5-(3-phenoxypropyl)benzene.
| Compound Name | 1,3-difluoro-2-methyl-5-(3-phenoxypropyl)benzene |
|---|---|
| PubChem CID | 59931472 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,3-difluoro-2-methyl-5-(3-phenoxypropyl)benzene |
| SMILES | Cc1c(F)cc(CCCOc2ccccc2)cc1F |
| InChI | InChI=1S/C16H16F2O/c1-12-15(17)10-13(11-16(12)18)6-5-9-19-14-7-3-2-4-8-14/h2-4,7-8,10-11H,5-6,9H2,1H3 |
| InChIKey | WDQZFNDPTXVZNL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|