C12H19N3 — CID 59931546
4-[(dimethylhydrazinylidene)methyl]-N,N,3-trimethylaniline (PubChem CID 59931546) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-[(dimethylhydrazinylidene)methyl]-N,N,3-trimethylaniline.
| Compound Name | 4-[(dimethylhydrazinylidene)methyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 59931546 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-[(dimethylhydrazinylidene)methyl]-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1C=NN(C)C |
| InChI | InChI=1S/C12H19N3/c1-10-8-12(14(2)3)7-6-11(10)9-13-15(4)5/h6-9H,1-5H3 |
| InChIKey | GGZXIBSMRGCYSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|