C17H18BN4O4PS2 — CID 59932222
CID 59932222 (PubChem CID 59932222) has the molecular formula C17H18BN4O4PS2 and a molecular weight of 448.28 g/mol.
| Compound Name | CID 59932222 |
|---|---|
| PubChem CID | 59932222 |
| Molecular Formula | C17H18BN4O4PS2 |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | — |
| SMILES | [B]/N=P/OC(=O)C1=C(SCCc2ncc3sccn23)[C@H](C)C2C(C(C)O)C(=O)N12 |
| InChI | InChI=1S/C17H18BN4O4PS2/c1-8-13-12(9(2)23)16(24)22(13)14(17(25)26-27-20-18)15(8)29-5-3-10-19-7-11-21(10)4-6-28-11/h4,6-9,12-13,23H,3,5H2,1-2H3/t8-,9?,12?,13?/m1/s1 |
| InChIKey | BCJOUGIXSOQJAC-PVIHBSMPSA-N |
| XLogP | 2.41 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|