C16H20BN4O4PS — CID 59932262
CID 59932262 (PubChem CID 59932262) has the molecular formula C16H20BN4O4PS and a molecular weight of 406.21 g/mol.
| Compound Name | CID 59932262 |
|---|---|
| PubChem CID | 59932262 |
| Molecular Formula | C16H20BN4O4PS |
| Molecular Weight | 406.21 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | — |
| SMILES | [B]/N=P/OC(=O)C1=C(SCCc2nccn2C)[C@H](C)C2C(C(C)O)C(=O)N12 |
| InChI | InChI=1S/C16H20BN4O4PS/c1-8-12-11(9(2)22)15(23)21(12)13(16(24)25-26-19-17)14(8)27-7-4-10-18-5-6-20(10)3/h5-6,8-9,11-12,22H,4,7H2,1-3H3/t8-,9?,11?,12?/m1/s1 |
| InChIKey | KNDYXEXXTDBSJN-NVGMAVIKSA-N |
| XLogP | 1.44 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|