About tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+)
tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) (PubChem CID 59934345) has the molecular formula C13H18NO2Rb
and a molecular weight of 305.76 g/mol. Its IUPAC name is tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+).
Molecular Properties
| Compound Name | tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) |
| PubChem CID | 59934345 |
| Molecular Formula | C13H18NO2Rb |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) |
| SMILES | CC(C)(C)OC(=O)NCCc1cc[c-]cc1.[Rb+] |
| InChI | InChI=1S/C13H18NO2.Rb/c1-13(2,3)16-12(15)14-10-9-11-7-5-4-6-8-11;/h5-8H,9-10H2,1-3H3,(H,14,15);/q-1;+1 |
| InChIKey | NDBMHJLVBAXBIE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+)?
The IUPAC name of tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) (CID 59934345) is tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+).
What is the SMILES notation for tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+)?
The canonical SMILES for tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) is CC(C)(C)OC(=O)NCCc1cc[c-]cc1.[Rb+].
What is the InChIKey of tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+)?
The InChIKey is NDBMHJLVBAXBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18NO2.Rb/c1-13(2,3)16-12(15)14-10-9-11-7-5-4-6-8-11;/h5-8H,9-10H2,1-3H3,(H,14,15);/q-1;+1.
What are the key properties of tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+)?
tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) has a molecular weight of 305.76 g/mol, XLogP of -0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-phenylethyl)carbamate;rubidium(1+) is sourced from PubChem (CID 59934345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).