C34H51NO4 — CID 59935459
(2-nitrophenyl)methyl 4-[(3R,7R,12S)-3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 59935459) has the molecular formula C34H51NO4 and a molecular weight of 537.79 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 4-[(3R,7R,12S)-3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | (2-nitrophenyl)methyl 4-[(3R,7R,12S)-3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 59935459 |
| Molecular Formula | C34H51NO4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | (2-nitrophenyl)methyl 4-[(3R,7R,12S)-3,7,10,12,13-pentamethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC1CC2C[C@H](C)CCC2(C)C2C[C@H](C)C3(C)C(C(C)CCC(=O)OCc4ccccc4[N+](=O)[O-])CCC3C12 |
| InChI | InChI=1S/C34H51NO4/c1-21-15-16-33(5)26(17-21)18-23(3)32-28-13-12-27(34(28,6)24(4)19-29(32)33)22(2)11-14-31(36)39-20-25-9-7-8-10-30(25)35(37)38/h7-10,21-24,26-29,32H,11-20H2,1-6H3/t21-,22?,23?,24+,26?,27?,28?,29?,32?,33?,34?/m1/s1 |
| InChIKey | XVOSAXIMPCWSAK-TUPCEMMMSA-N |
| XLogP | 8.84 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|