C28H48O4 — CID 59963676
methoxymethyl (4R)-4-[(7R,10S,12S,13R,17R)-3-hydroxy-7,10,12,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 59963676) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is methoxymethyl (4R)-4-[(7R,10S,12S,13R,17R)-3-hydroxy-7,10,12,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methoxymethyl (4R)-4-[(7R,10S,12S,13R,17R)-3-hydroxy-7,10,12,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 59963676 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | methoxymethyl (4R)-4-[(7R,10S,12S,13R,17R)-3-hydroxy-7,10,12,13-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCOC(=O)CC[C@@H](C)[C@H]1CCC2C3C(C)CC4CC(O)CC[C@]4(C)C3C[C@H](C)[C@@]21C |
| InChI | InChI=1S/C28H48O4/c1-17(7-10-25(30)32-16-31-6)22-8-9-23-26-18(2)13-20-15-21(29)11-12-27(20,4)24(26)14-19(3)28(22,23)5/h17-24,26,29H,7-16H2,1-6H3/t17-,18?,19+,20?,21?,22-,23?,24?,26?,27+,28-/m1/s1 |
| InChIKey | MFKQAXBSYQTZLX-DLVUXVGSSA-N |
| XLogP | 6.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|