C12H9BrO4S — CID 59938246
3-[2-(4-bromothiophen-2-yl)acetyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 59938246) has the molecular formula C12H9BrO4S and a molecular weight of 329.17 g/mol. Its IUPAC name is 3-[2-(4-bromothiophen-2-yl)acetyl]-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-[2-(4-bromothiophen-2-yl)acetyl]-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 59938246 |
| Molecular Formula | C12H9BrO4S |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 327.94 |
| IUPAC Name | 3-[2-(4-bromothiophen-2-yl)acetyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)Cc2cc(Br)cs2)c(=O)o1 |
| InChI | InChI=1S/C12H9BrO4S/c1-6-2-9(14)11(12(16)17-6)10(15)4-8-3-7(13)5-18-8/h2-3,5,14H,4H2,1H3 |
| InChIKey | JSQNEKGVRDKGRO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |