C14H18O6 — CID 71527239
8-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-8-oxooctanoic acid (PubChem CID 71527239) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 8-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-8-oxooctanoic acid.
| Compound Name | 8-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-8-oxooctanoic acid |
|---|---|
| PubChem CID | 71527239 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 8-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-8-oxooctanoic acid |
| SMILES | Cc1cc(O)c(C(=O)CCCCCCC(=O)O)c(=O)o1 |
| InChI | InChI=1S/C14H18O6/c1-9-8-11(16)13(14(19)20-9)10(15)6-4-2-3-5-7-12(17)18/h8,16H,2-7H2,1H3,(H,17,18) |
| InChIKey | VBYFBCFSMJXJCU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|