C19H28O4 — CID 12906132
10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid (PubChem CID 12906132) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid.
| Compound Name | 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid |
|---|---|
| PubChem CID | 12906132 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid |
| SMILES | Cc1cc(C)c(C(=O)CCCCCCCCC(=O)O)c(O)c1C |
| InChI | InChI=1S/C19H28O4/c1-13-12-14(2)18(19(23)15(13)3)16(20)10-8-6-4-5-7-9-11-17(21)22/h12,23H,4-11H2,1-3H3,(H,21,22) |
| InChIKey | LRQXFYIZXFGRGB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|