10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid

C19H28O4 — CID 12906132

IUPAC10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid
SMILESCc1cc(C)c(C(=O)CCCCCCCCC(=O)O)c(O)c1C
InChIInChI=1S/C19H28O4/c1-13-12-14(2)18(19(23)15(13)3)16(20)10-8-6-4-5-7-9-11-17(21)22/h12,23H,4-11H2,1-3H3,(H,21,22)
InChIKeyLRQXFYIZXFGRGB-UHFFFAOYSA-N
MW320.43 g/mol
LogP4.71
Rot. Bonds10

About 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid

10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid (PubChem CID 12906132) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid.

Molecular Properties

Compound Name10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid
PubChem CID12906132
Molecular FormulaC19H28O4
Molecular Weight320.43 g/mol
Exact Mass320.20
IUPAC Name10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid
SMILESCc1cc(C)c(C(=O)CCCCCCCCC(=O)O)c(O)c1C
InChIInChI=1S/C19H28O4/c1-13-12-14(2)18(19(23)15(13)3)16(20)10-8-6-4-5-7-9-11-17(21)22/h12,23H,4-11H2,1-3H3,(H,21,22)
InChIKeyLRQXFYIZXFGRGB-UHFFFAOYSA-N
XLogP4.71
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.43
LogP ≤ 54.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid?
The IUPAC name of 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid (CID 12906132) is 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid.
What is the SMILES notation for 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid?
The canonical SMILES for 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid is Cc1cc(C)c(C(=O)CCCCCCCCC(=O)O)c(O)c1C.
What is the InChIKey of 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid?
The InChIKey is LRQXFYIZXFGRGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O4/c1-13-12-14(2)18(19(23)15(13)3)16(20)10-8-6-4-5-7-9-11-17(21)22/h12,23H,4-11H2,1-3H3,(H,21,22).
What are the key properties of 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid?
10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid has a molecular weight of 320.43 g/mol, XLogP of 4.71, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2-hydroxy-3,4,6-trimethylphenyl)-10-oxodecanoic acid is sourced from PubChem (CID 12906132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).