About gold;heptanedioic acid
gold;heptanedioic acid (PubChem CID 174896169) has the molecular formula C7H12Au2O4
and a molecular weight of 554.10 g/mol. Its IUPAC name is gold;heptanedioic acid.
Molecular Properties
| Compound Name | gold;heptanedioic acid |
| PubChem CID | 174896169 |
| Molecular Formula | C7H12Au2O4 |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | gold;heptanedioic acid |
| SMILES | O=C(O)CCCCCC(=O)O.[Au].[Au] |
| InChI | InChI=1S/C7H12O4.2Au/c8-6(9)4-2-1-3-5-7(10)11;;/h1-5H2,(H,8,9)(H,10,11);; |
| InChIKey | BERZGVYTQCAJEZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze gold;heptanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;heptanedioic acid?
The IUPAC name of gold;heptanedioic acid (CID 174896169) is gold;heptanedioic acid.
What is the SMILES notation for gold;heptanedioic acid?
The canonical SMILES for gold;heptanedioic acid is O=C(O)CCCCCC(=O)O.[Au].[Au].
What is the InChIKey of gold;heptanedioic acid?
The InChIKey is BERZGVYTQCAJEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4.2Au/c8-6(9)4-2-1-3-5-7(10)11;;/h1-5H2,(H,8,9)(H,10,11);;.
What are the key properties of gold;heptanedioic acid?
gold;heptanedioic acid has a molecular weight of 554.10 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;heptanedioic acid is sourced from PubChem (CID 174896169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).