C16H22O4 — CID 12906129
7-(2-hydroxy-3,4,6-trimethylphenyl)-7-oxoheptanoic acid (PubChem CID 12906129) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 7-(2-hydroxy-3,4,6-trimethylphenyl)-7-oxoheptanoic acid.
| Compound Name | 7-(2-hydroxy-3,4,6-trimethylphenyl)-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 12906129 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 7-(2-hydroxy-3,4,6-trimethylphenyl)-7-oxoheptanoic acid |
| SMILES | Cc1cc(C)c(C(=O)CCCCCC(=O)O)c(O)c1C |
| InChI | InChI=1S/C16H22O4/c1-10-9-11(2)15(16(20)12(10)3)13(17)7-5-4-6-8-14(18)19/h9,20H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | MVLOLUZRGUDQDK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|