C9H18FNO — CID 59938453
5-fluoro-N,2,4,6-tetramethyloxan-3-amine (PubChem CID 59938453) has the molecular formula C9H18FNO and a molecular weight of 175.25 g/mol. Its IUPAC name is 5-fluoro-N,2,4,6-tetramethyloxan-3-amine.
| Compound Name | 5-fluoro-N,2,4,6-tetramethyloxan-3-amine |
|---|---|
| PubChem CID | 59938453 |
| Molecular Formula | C9H18FNO |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-fluoro-N,2,4,6-tetramethyloxan-3-amine |
| SMILES | CNC1C(C)OC(C)C(F)C1C |
| InChI | InChI=1S/C9H18FNO/c1-5-8(10)6(2)12-7(3)9(5)11-4/h5-9,11H,1-4H3 |
| InChIKey | CYLOXHGBOBOABN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |