C15H13N3O3S — CID 59939121
N-(5-cyano-2-methyl-4-pyridinyl)-N-methoxysulfinylbenzamide (PubChem CID 59939121) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(5-cyano-2-methyl-4-pyridinyl)-N-methoxysulfinylbenzamide.
| Compound Name | N-(5-cyano-2-methyl-4-pyridinyl)-N-methoxysulfinylbenzamide |
|---|---|
| PubChem CID | 59939121 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(5-cyano-2-methyl-4-pyridinyl)-N-methoxysulfinylbenzamide |
| SMILES | COS(=O)N(C(=O)c1ccccc1)c1cc(C)ncc1C#N |
| InChI | InChI=1S/C15H13N3O3S/c1-11-8-14(13(9-16)10-17-11)18(22(20)21-2)15(19)12-6-4-3-5-7-12/h3-8,10H,1-2H3 |
| InChIKey | GJQGXJHXQMEFFU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |