C13H22O4 — CID 59942607
1-(2-hydroperoxy-1,3,6,7-tetramethyl-2-bicyclo[3.2.0]heptanyl)-2-hydroxyethanone (PubChem CID 59942607) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-(2-hydroperoxy-1,3,6,7-tetramethyl-2-bicyclo[3.2.0]heptanyl)-2-hydroxyethanone.
| Compound Name | 1-(2-hydroperoxy-1,3,6,7-tetramethyl-2-bicyclo[3.2.0]heptanyl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 59942607 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(2-hydroperoxy-1,3,6,7-tetramethyl-2-bicyclo[3.2.0]heptanyl)-2-hydroxyethanone |
| SMILES | CC1C(C)C2(C)C1CC(C)C2(OO)C(=O)CO |
| InChI | InChI=1S/C13H22O4/c1-7-5-10-8(2)9(3)12(10,4)13(7,17-16)11(15)6-14/h7-10,14,16H,5-6H2,1-4H3 |
| InChIKey | KQQVLBRSJXCOBK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|