C25H31BrO6 — CID 70626588
[(8S,9S,10R,13S,14S,17R)-7-bromo-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 70626588) has the molecular formula C25H31BrO6 and a molecular weight of 507.42 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-7-bromo-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-7-bromo-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 70626588 |
| Molecular Formula | C25H31BrO6 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-7-bromo-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CO)C(C)C[C@H]2[C@@H]3C(Br)CC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C25H31BrO6/c1-5-20(31)32-25(19(30)12-27)13(2)8-16-21-17(26)10-14-9-15(28)6-7-23(14,3)22(21)18(29)11-24(16,25)4/h6-7,9,13,16-17,21-22,27H,5,8,10-12H2,1-4H3/t13?,16-,17?,21+,22-,23-,24-,25-/m0/s1 |
| InChIKey | FNCLSWGQZMEEMT-FBKVCVBISA-N |
| XLogP | 3.35 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|