C31H33BrO7 — CID 70616018
[(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-bromo-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70616018) has the molecular formula C31H33BrO7 and a molecular weight of 597.50 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-bromo-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-bromo-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70616018 |
| Molecular Formula | C31H33BrO7 |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-bromo-10,13,16-trimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(=O)c2ccccc2)C(C)C[C@H]2[C@@H]3C(Br)CC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C31H33BrO7/c1-17-12-22-26-23(32)14-20-13-21(34)10-11-29(20,3)27(26)24(35)15-30(22,4)31(17,25(36)16-38-18(2)33)39-28(37)19-8-6-5-7-9-19/h5-11,13,17,22-23,26-27H,12,14-16H2,1-4H3/t17?,22-,23?,26+,27-,29-,30-,31-/m0/s1 |
| InChIKey | XLVKWLVQIYGBSI-JHPKDMRJSA-N |
| XLogP | 4.82 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|