C8H12O4 — CID 59944008
(3aR,4R,6aR)-4-ethyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one (PubChem CID 59944008) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3aR,4R,6aR)-4-ethyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one.
| Compound Name | (3aR,4R,6aR)-4-ethyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
|---|---|
| PubChem CID | 59944008 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (3aR,4R,6aR)-4-ethyl-6-hydroxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-2-one |
| SMILES | CC[C@H]1OC(O)[C@@H]2OC(=O)C[C@H]12 |
| InChI | InChI=1S/C8H12O4/c1-2-5-4-3-6(9)12-7(4)8(10)11-5/h4-5,7-8,10H,2-3H2,1H3/t4-,5-,7-,8?/m1/s1 |
| InChIKey | DNFKPJDPPFHEHH-KZMCMFIFSA-N |
| XLogP | 0.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |