C34H43N5O3S — CID 59944552
N-[2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butylamino]ethyl]-1H-indol-5-yl]pyrrolidine-1-carboxamide (PubChem CID 59944552) has the molecular formula C34H43N5O3S and a molecular weight of 601.82 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butylamino]ethyl]-1H-indol-5-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butylamino]ethyl]-1H-indol-5-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 59944552 |
| Molecular Formula | C34H43N5O3S |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | N-[2-(3,5-dimethylphenyl)-3-[2-[4-[4-(methanesulfonamido)phenyl]butylamino]ethyl]-1H-indol-5-yl]pyrrolidine-1-carboxamide |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccc(NC(=O)N4CCCC4)cc3c2CCNCCCCc2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C34H43N5O3S/c1-24-20-25(2)22-27(21-24)33-30(31-23-29(13-14-32(31)37-33)36-34(40)39-18-6-7-19-39)15-17-35-16-5-4-8-26-9-11-28(12-10-26)38-43(3,41)42/h9-14,20-23,35,37-38H,4-8,15-19H2,1-3H3,(H,36,40) |
| InChIKey | OHBMWNLTWAEEAD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|