C26H38O2 — CID 59946434
3-[(3E,5E,7E,9E,11Z)-2-methoxy-3,7-dimethyltrideca-3,5,7,9,11-pentaenyl]-2,4,4,6-tetramethylcyclohex-2-en-1-one (PubChem CID 59946434) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 3-[(3E,5E,7E,9E,11Z)-2-methoxy-3,7-dimethyltrideca-3,5,7,9,11-pentaenyl]-2,4,4,6-tetramethylcyclohex-2-en-1-one.
| Compound Name | 3-[(3E,5E,7E,9E,11Z)-2-methoxy-3,7-dimethyltrideca-3,5,7,9,11-pentaenyl]-2,4,4,6-tetramethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 59946434 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 3-[(3E,5E,7E,9E,11Z)-2-methoxy-3,7-dimethyltrideca-3,5,7,9,11-pentaenyl]-2,4,4,6-tetramethylcyclohex-2-en-1-one |
| SMILES | C/C=C\C=C\C=C(C)\C=C\C=C(/C)C(CC1=C(C)C(=O)C(C)CC1(C)C)OC |
| InChI | InChI=1S/C26H38O2/c1-9-10-11-12-14-19(2)15-13-16-20(3)24(28-8)17-23-22(5)25(27)21(4)18-26(23,6)7/h9-16,21,24H,17-18H2,1-8H3/b10-9-,12-11+,15-13+,19-14+,20-16+ |
| InChIKey | VPNQISPJSCNDHH-XBSLOXIDSA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|