About 3-(2-oxobutoxy)propyl 2-(methylamino)acetate
3-(2-oxobutoxy)propyl 2-(methylamino)acetate (PubChem CID 59946828) has the molecular formula C10H19NO4
and a molecular weight of 217.26 g/mol. Its IUPAC name is 3-(2-oxobutoxy)propyl 2-(methylamino)acetate.
Molecular Properties
| Compound Name | 3-(2-oxobutoxy)propyl 2-(methylamino)acetate |
| PubChem CID | 59946828 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 3-(2-oxobutoxy)propyl 2-(methylamino)acetate |
| SMILES | CCC(=O)COCCCOC(=O)CNC |
| InChI | InChI=1S/C10H19NO4/c1-3-9(12)8-14-5-4-6-15-10(13)7-11-2/h11H,3-8H2,1-2H3 |
| InChIKey | CAEFTEMORQHVNJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-oxobutoxy)propyl 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxobutoxy)propyl 2-(methylamino)acetate?
The IUPAC name of 3-(2-oxobutoxy)propyl 2-(methylamino)acetate (CID 59946828) is 3-(2-oxobutoxy)propyl 2-(methylamino)acetate.
What is the SMILES notation for 3-(2-oxobutoxy)propyl 2-(methylamino)acetate?
The canonical SMILES for 3-(2-oxobutoxy)propyl 2-(methylamino)acetate is CCC(=O)COCCCOC(=O)CNC.
What is the InChIKey of 3-(2-oxobutoxy)propyl 2-(methylamino)acetate?
The InChIKey is CAEFTEMORQHVNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-3-9(12)8-14-5-4-6-15-10(13)7-11-2/h11H,3-8H2,1-2H3.
What are the key properties of 3-(2-oxobutoxy)propyl 2-(methylamino)acetate?
3-(2-oxobutoxy)propyl 2-(methylamino)acetate has a molecular weight of 217.26 g/mol, XLogP of 0.13, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxobutoxy)propyl 2-(methylamino)acetate is sourced from PubChem (CID 59946828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).