C34H38N6O5S — CID 59948287
3-[[4-[[1H-benzimidazol-2-ylmethyl(cyclohexylcarbamothioyl)amino]methyl]benzoyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 59948287) has the molecular formula C34H38N6O5S and a molecular weight of 642.78 g/mol. Its IUPAC name is 3-[[4-[[1H-benzimidazol-2-ylmethyl(cyclohexylcarbamothioyl)amino]methyl]benzoyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[4-[[1H-benzimidazol-2-ylmethyl(cyclohexylcarbamothioyl)amino]methyl]benzoyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 59948287 |
| Molecular Formula | C34H38N6O5S |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | 3-[[4-[[1H-benzimidazol-2-ylmethyl(cyclohexylcarbamothioyl)amino]methyl]benzoyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(CNC(=O)c1ccc(CN(Cc2nc3ccccc3[nH]2)C(=S)NC2CCCCC2)cc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C34H38N6O5S/c41-31(35-19-29(32(42)43)39-34(44)45-22-24-9-3-1-4-10-24)25-17-15-23(16-18-25)20-40(33(46)36-26-11-5-2-6-12-26)21-30-37-27-13-7-8-14-28(27)38-30/h1,3-4,7-10,13-18,26,29H,2,5-6,11-12,19-22H2,(H,35,41)(H,36,46)(H,37,38)(H,39,44)(H,42,43) |
| InChIKey | AMEXTMCFLZDKIX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 148.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|