C15H20BrNO4 — CID 59949573
methyl (2S)-2-[(4-bromo-3-methoxybenzoyl)amino]-3-methylpentanoate (PubChem CID 59949573) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is methyl (2S)-2-[(4-bromo-3-methoxybenzoyl)amino]-3-methylpentanoate.
| Compound Name | methyl (2S)-2-[(4-bromo-3-methoxybenzoyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 59949573 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | methyl (2S)-2-[(4-bromo-3-methoxybenzoyl)amino]-3-methylpentanoate |
| SMILES | CCC(C)[C@H](NC(=O)c1ccc(Br)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C15H20BrNO4/c1-5-9(2)13(15(19)21-4)17-14(18)10-6-7-11(16)12(8-10)20-3/h6-9,13H,5H2,1-4H3,(H,17,18)/t9?,13-/m0/s1 |
| InChIKey | JLLLICFFHZKSNB-NCWAPJAISA-N |
| XLogP | 2.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |