C18H26N4O3 — CID 59950585
2-[4-[[3-[3-(methylamino)-2-oxoazepan-1-yl]-2-oxopropyl]amino]phenyl]acetamide (PubChem CID 59950585) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[4-[[3-[3-(methylamino)-2-oxoazepan-1-yl]-2-oxopropyl]amino]phenyl]acetamide.
| Compound Name | 2-[4-[[3-[3-(methylamino)-2-oxoazepan-1-yl]-2-oxopropyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 59950585 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-[4-[[3-[3-(methylamino)-2-oxoazepan-1-yl]-2-oxopropyl]amino]phenyl]acetamide |
| SMILES | CNC1CCCCN(CC(=O)CNc2ccc(CC(N)=O)cc2)C1=O |
| InChI | InChI=1S/C18H26N4O3/c1-20-16-4-2-3-9-22(18(16)25)12-15(23)11-21-14-7-5-13(6-8-14)10-17(19)24/h5-8,16,20-21H,2-4,9-12H2,1H3,(H2,19,24) |
| InChIKey | SGDQWSHUUFWTKL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |