C31H31N5O3 — CID 22945929
N-[1-[3-[(1-aminoisoquinolin-6-yl)amino]-2-oxopropyl]-2-oxoazepan-3-yl]-4-phenylbenzamide (PubChem CID 22945929) has the molecular formula C31H31N5O3 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[1-[3-[(1-aminoisoquinolin-6-yl)amino]-2-oxopropyl]-2-oxoazepan-3-yl]-4-phenylbenzamide.
| Compound Name | N-[1-[3-[(1-aminoisoquinolin-6-yl)amino]-2-oxopropyl]-2-oxoazepan-3-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 22945929 |
| Molecular Formula | C31H31N5O3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[1-[3-[(1-aminoisoquinolin-6-yl)amino]-2-oxopropyl]-2-oxoazepan-3-yl]-4-phenylbenzamide |
| SMILES | Nc1nccc2cc(NCC(=O)CN3CCCCC(NC(=O)c4ccc(-c5ccccc5)cc4)C3=O)ccc12 |
| InChI | InChI=1S/C31H31N5O3/c32-29-27-14-13-25(18-24(27)15-16-33-29)34-19-26(37)20-36-17-5-4-8-28(31(36)39)35-30(38)23-11-9-22(10-12-23)21-6-2-1-3-7-21/h1-3,6-7,9-16,18,28,34H,4-5,8,17,19-20H2,(H2,32,33)(H,35,38) |
| InChIKey | MLWYYXUCTAQGRS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |