C30H32N4O3 — CID 74011862
N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(4-phenylphenyl)prop-2-enamide (PubChem CID 74011862) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(4-phenylphenyl)prop-2-enamide.
| Compound Name | N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 74011862 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-3-(4-phenylphenyl)prop-2-enamide |
| SMILES | NCc1cccc(NC(=O)CN2CCCCC(NC(=O)C=Cc3ccc(-c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C30H32N4O3/c31-20-23-7-6-10-26(19-23)32-29(36)21-34-18-5-4-11-27(30(34)37)33-28(35)17-14-22-12-15-25(16-13-22)24-8-2-1-3-9-24/h1-3,6-10,12-17,19,27H,4-5,11,18,20-21,31H2,(H,32,36)(H,33,35) |
| InChIKey | YXZWDUJUJYPTPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|