C27H36N6O3S — CID 142114286
N-[3-(aminomethyl)phenyl]-2-[3-[[1-hydroxy-2-(5-pyrazin-2-ylthiophen-3-yl)ethyl]amino]-2-oxoazepan-1-yl]acetamide;ethane (PubChem CID 142114286) has the molecular formula C27H36N6O3S and a molecular weight of 524.69 g/mol. Its IUPAC name is N-[3-(aminomethyl)phenyl]-2-[3-[[1-hydroxy-2-(5-pyrazin-2-ylthiophen-3-yl)ethyl]amino]-2-oxoazepan-1-yl]acetamide;ethane.
| Compound Name | N-[3-(aminomethyl)phenyl]-2-[3-[[1-hydroxy-2-(5-pyrazin-2-ylthiophen-3-yl)ethyl]amino]-2-oxoazepan-1-yl]acetamide;ethane |
|---|---|
| PubChem CID | 142114286 |
| Molecular Formula | C27H36N6O3S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | N-[3-(aminomethyl)phenyl]-2-[3-[[1-hydroxy-2-(5-pyrazin-2-ylthiophen-3-yl)ethyl]amino]-2-oxoazepan-1-yl]acetamide;ethane |
| SMILES | CC.NCc1cccc(NC(=O)CN2CCCCC(NC(O)Cc3csc(-c4cnccn4)c3)C2=O)c1 |
| InChI | InChI=1S/C25H30N6O3S.C2H6/c26-13-17-4-3-5-19(10-17)29-24(33)15-31-9-2-1-6-20(25(31)34)30-23(32)12-18-11-22(35-16-18)21-14-27-7-8-28-21;1-2/h3-5,7-8,10-11,14,16,20,23,30,32H,1-2,6,9,12-13,15,26H2,(H,29,33);1-2H3 |
| InChIKey | DPJSYUPIFKOWCZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|