C29H42N4O3 — CID 142114377
N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-5-(4-methylphenyl)pentanamide;ethane (PubChem CID 142114377) has the molecular formula C29H42N4O3 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-5-(4-methylphenyl)pentanamide;ethane.
| Compound Name | N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-5-(4-methylphenyl)pentanamide;ethane |
|---|---|
| PubChem CID | 142114377 |
| Molecular Formula | C29H42N4O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | N-[1-[2-[3-(aminomethyl)anilino]-2-oxoethyl]-2-oxoazepan-3-yl]-5-(4-methylphenyl)pentanamide;ethane |
| SMILES | CC.Cc1ccc(CCCCC(=O)NC2CCCCN(CC(=O)Nc3cccc(CN)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H36N4O3.C2H6/c1-20-12-14-21(15-13-20)7-2-3-11-25(32)30-24-10-4-5-16-31(27(24)34)19-26(33)29-23-9-6-8-22(17-23)18-28;1-2/h6,8-9,12-15,17,24H,2-5,7,10-11,16,18-19,28H2,1H3,(H,29,33)(H,30,32);1-2H3 |
| InChIKey | PILNAWCHDUUNAM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|