C22H20N2O — CID 59951291
(2Z)-2-(1-ethylbenzo[cd]indol-2-ylidene)-N-(4-methoxyphenyl)ethanimine (PubChem CID 59951291) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (2Z)-2-(1-ethylbenzo[cd]indol-2-ylidene)-N-(4-methoxyphenyl)ethanimine.
| Compound Name | (2Z)-2-(1-ethylbenzo[cd]indol-2-ylidene)-N-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 59951291 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2Z)-2-(1-ethylbenzo[cd]indol-2-ylidene)-N-(4-methoxyphenyl)ethanimine |
| SMILES | CCn1/c(=C\C=N\c2ccc(OC)cc2)c2cccc3cccc1c32 |
| InChI | InChI=1S/C22H20N2O/c1-3-24-20(14-15-23-17-10-12-18(25-2)13-11-17)19-8-4-6-16-7-5-9-21(24)22(16)19/h4-15H,3H2,1-2H3/b20-14-,23-15+ |
| InChIKey | NSMNNDILODXDGX-PDIADDBYSA-N |
| XLogP | 4.72 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|