C24H20Br2 — CID 59951418
1,4-dibromo-2,5-bis[2-(3-methylphenyl)ethenyl]benzene (PubChem CID 59951418) has the molecular formula C24H20Br2 and a molecular weight of 468.23 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[2-(3-methylphenyl)ethenyl]benzene.
| Compound Name | 1,4-dibromo-2,5-bis[2-(3-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 59951418 |
| Molecular Formula | C24H20Br2 |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 1,4-dibromo-2,5-bis[2-(3-methylphenyl)ethenyl]benzene |
| SMILES | Cc1cccc(C=Cc2cc(Br)c(C=Cc3cccc(C)c3)cc2Br)c1 |
| InChI | InChI=1S/C24H20Br2/c1-17-5-3-7-19(13-17)9-11-21-15-24(26)22(16-23(21)25)12-10-20-8-4-6-18(2)14-20/h3-16H,1-2H3 |
| InChIKey | UYCCOFBGSFGDQA-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|