C17H21NO3 — CID 59951666
(4R)-4-benzyl-3-(5-methylhex-5-enoyl)-1,3-oxazolidin-2-one (PubChem CID 59951666) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (4R)-4-benzyl-3-(5-methylhex-5-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-(5-methylhex-5-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59951666 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (4R)-4-benzyl-3-(5-methylhex-5-enoyl)-1,3-oxazolidin-2-one |
| SMILES | C=C(C)CCCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-13(2)7-6-10-16(19)18-15(12-21-17(18)20)11-14-8-4-3-5-9-14/h3-5,8-9,15H,1,6-7,10-12H2,2H3/t15-/m1/s1 |
| InChIKey | WWFURXDDRMRVAP-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|