C10H10NSW- — CID 59951873
2,3,5-trimethyl-7H-thieno[3,2-b]pyridin-7-ide;tungsten (PubChem CID 59951873) has the molecular formula C10H10NSW- and a molecular weight of 360.10 g/mol. Its IUPAC name is 2,3,5-trimethyl-7H-thieno[3,2-b]pyridin-7-ide;tungsten.
| Compound Name | 2,3,5-trimethyl-7H-thieno[3,2-b]pyridin-7-ide;tungsten |
|---|---|
| PubChem CID | 59951873 |
| Molecular Formula | C10H10NSW- |
| Molecular Weight | 360.10 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2,3,5-trimethyl-7H-thieno[3,2-b]pyridin-7-ide;tungsten |
| SMILES | Cc1c[c-]c2sc(C)c(C)c2n1.[W] |
| InChI | InChI=1S/C10H10NS.W/c1-6-4-5-9-10(11-6)7(2)8(3)12-9;/h4H,1-3H3;/q-1; |
| InChIKey | RHTSWOCLIJEPPV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|