About 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene
4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene (PubChem CID 54566958) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene.
Molecular Properties
| Compound Name | 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene |
| PubChem CID | 54566958 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene |
| SMILES | [C-]#[N+]c1c(C=CC(C)C)sc(C)c1C |
| InChI | InChI=1S/C12H15NS/c1-8(2)6-7-11-12(13-5)9(3)10(4)14-11/h6-8H,1-4H3 |
| InChIKey | ZUMVTFQQFUSQAH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene?
The IUPAC name of 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene (CID 54566958) is 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene.
What is the SMILES notation for 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene?
The canonical SMILES for 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene is [C-]#[N+]c1c(C=CC(C)C)sc(C)c1C.
What is the InChIKey of 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene?
The InChIKey is ZUMVTFQQFUSQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-8(2)6-7-11-12(13-5)9(3)10(4)14-11/h6-8H,1-4H3.
What are the key properties of 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene?
4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene has a molecular weight of 205.33 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyano-2,3-dimethyl-5-(3-methylbut-1-enyl)thiophene is sourced from PubChem (CID 54566958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).