C10H11NS — CID 58011205
3-isocyano-2-methyl-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 58011205) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 3-isocyano-2-methyl-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 3-isocyano-2-methyl-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 58011205 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 3-isocyano-2-methyl-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | [C-]#[N+]c1c(C)sc2c1CCCC2 |
| InChI | InChI=1S/C10H11NS/c1-7-10(11-2)8-5-3-4-6-9(8)12-7/h3-6H2,1H3 |
| InChIKey | LJJIDZFXEDTSRQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|