C9H9NS — CID 58011204
3-isocyano-2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 58011204) has the molecular formula C9H9NS and a molecular weight of 163.24 g/mol. Its IUPAC name is 3-isocyano-2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 3-isocyano-2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 58011204 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-isocyano-2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | [C-]#[N+]c1c(C)sc2c1CCC2 |
| InChI | InChI=1S/C9H9NS/c1-6-9(10-2)7-4-3-5-8(7)11-6/h3-5H2,1H3 |
| InChIKey | ACIZXKKLFUACRN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|